C21H20O4 — CID 101122001
ethyl (1R,13R)-11,18-dioxoheptacyclo[11.2.2.12,8.02,12.03,7.04,12.05,9]octadeca-14,16-diene-14-carboxylate (PubChem CID 101122001) has the molecular formula C21H20O4 and a molecular weight of 336.39 g/mol. Its IUPAC name is ethyl (1R,13R)-11,18-dioxoheptacyclo[11.2.2.12,8.02,12.03,7.04,12.05,9]octadeca-14,16-diene-14-carboxylate.
| Compound Name | ethyl (1R,13R)-11,18-dioxoheptacyclo[11.2.2.12,8.02,12.03,7.04,12.05,9]octadeca-14,16-diene-14-carboxylate |
|---|---|
| PubChem CID | 101122001 |
| Molecular Formula | C21H20O4 |
| Molecular Weight | 336.39 g/mol |
| Exact Mass | 336.14 |
| IUPAC Name | ethyl (1R,13R)-11,18-dioxoheptacyclo[11.2.2.12,8.02,12.03,7.04,12.05,9]octadeca-14,16-diene-14-carboxylate |
| SMILES | CCOC(=O)C1=CC2C=CC1C13C(=O)CC4C5CC6C4C(=O)C21C6C53 |
| InChI | InChI=1S/C21H20O4/c1-2-25-19(24)11-5-8-3-4-13(11)21-14(22)7-9-10-6-12-15(9)18(23)20(8,21)17(12)16(10)21/h3-5,8-10,12-13,15-17H,2,6-7H2,1H3 |
| InChIKey | VHDDDIZWVDEDEF-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.39 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|