C9H9BrO2 — CID 87092106
ethyl 6-bromocyclohexa-1,3,4-triene-1-carboxylate (PubChem CID 87092106) has the molecular formula C9H9BrO2 and a molecular weight of 229.07 g/mol. Its IUPAC name is ethyl 6-bromocyclohexa-1,3,4-triene-1-carboxylate.
| Compound Name | ethyl 6-bromocyclohexa-1,3,4-triene-1-carboxylate |
|---|---|
| PubChem CID | 87092106 |
| Molecular Formula | C9H9BrO2 |
| Molecular Weight | 229.07 g/mol |
| Exact Mass | 227.98 |
| IUPAC Name | ethyl 6-bromocyclohexa-1,3,4-triene-1-carboxylate |
| SMILES | CCOC(=O)C1=CC=C=CC1Br |
| InChI | InChI=1S/C9H9BrO2/c1-2-12-9(11)7-5-3-4-6-8(7)10/h3,5-6,8H,2H2,1H3 |
| InChIKey | QTEYANRQXNEJIG-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.07 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|