C15H15NO3 — CID 162407205
ethyl 9-hydroxy-6,9-dihydropyrido[1,2-a]indole-8-carboxylate (PubChem CID 162407205) has the molecular formula C15H15NO3 and a molecular weight of 257.29 g/mol. Its IUPAC name is ethyl 9-hydroxy-6,9-dihydropyrido[1,2-a]indole-8-carboxylate.
| Compound Name | ethyl 9-hydroxy-6,9-dihydropyrido[1,2-a]indole-8-carboxylate |
|---|---|
| PubChem CID | 162407205 |
| Molecular Formula | C15H15NO3 |
| Molecular Weight | 257.29 g/mol |
| Exact Mass | 257.11 |
| IUPAC Name | ethyl 9-hydroxy-6,9-dihydropyrido[1,2-a]indole-8-carboxylate |
| SMILES | CCOC(=O)C1=CCn2c(cc3ccccc32)C1O |
| InChI | InChI=1S/C15H15NO3/c1-2-19-15(18)11-7-8-16-12-6-4-3-5-10(12)9-13(16)14(11)17/h3-7,9,14,17H,2,8H2,1H3 |
| InChIKey | BZKWHONOSCMTAC-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 51.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.29 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |