C15H17NO2 — CID 15063389
ethyl 6,7,8,9-tetrahydropyrido[1,2-a]indole-8-carboxylate (PubChem CID 15063389) has the molecular formula C15H17NO2 and a molecular weight of 243.31 g/mol. Its IUPAC name is ethyl 6,7,8,9-tetrahydropyrido[1,2-a]indole-8-carboxylate.
| Compound Name | ethyl 6,7,8,9-tetrahydropyrido[1,2-a]indole-8-carboxylate |
|---|---|
| PubChem CID | 15063389 |
| Molecular Formula | C15H17NO2 |
| Molecular Weight | 243.31 g/mol |
| Exact Mass | 243.13 |
| IUPAC Name | ethyl 6,7,8,9-tetrahydropyrido[1,2-a]indole-8-carboxylate |
| SMILES | CCOC(=O)C1CCn2c(cc3ccccc32)C1 |
| InChI | InChI=1S/C15H17NO2/c1-2-18-15(17)12-7-8-16-13(10-12)9-11-5-3-4-6-14(11)16/h3-6,9,12H,2,7-8,10H2,1H3 |
| InChIKey | VBMGKNNNZFMWCP-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.31 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |