About ethyl 1-oxo-2,3-dihydropyrrolo[1,2-a]indole-2-carboxylate
ethyl 1-oxo-2,3-dihydropyrrolo[1,2-a]indole-2-carboxylate (PubChem CID 67807991) has the molecular formula C14H13NO3
and a molecular weight of 243.26 g/mol. Its IUPAC name is ethyl 1-oxo-2,3-dihydropyrrolo[1,2-a]indole-2-carboxylate.
Molecular Properties
| Compound Name | ethyl 1-oxo-2,3-dihydropyrrolo[1,2-a]indole-2-carboxylate |
| PubChem CID | 67807991 |
| Molecular Formula | C14H13NO3 |
| Molecular Weight | 243.26 g/mol |
| Exact Mass | 243.09 |
| IUPAC Name | ethyl 1-oxo-2,3-dihydropyrrolo[1,2-a]indole-2-carboxylate |
| SMILES | CCOC(=O)C1Cc2cc3ccccc3n2C1=O |
| InChI | InChI=1S/C14H13NO3/c1-2-18-14(17)11-8-10-7-9-5-3-4-6-12(9)15(10)13(11)16/h3-7,11H,2,8H2,1H3 |
| InChIKey | AVVYDQDHYRCHAH-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 48.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.26 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze ethyl 1-oxo-2,3-dihydropyrrolo[1,2-a]indole-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 1-oxo-2,3-dihydropyrrolo[1,2-a]indole-2-carboxylate?
The IUPAC name of ethyl 1-oxo-2,3-dihydropyrrolo[1,2-a]indole-2-carboxylate (CID 67807991) is ethyl 1-oxo-2,3-dihydropyrrolo[1,2-a]indole-2-carboxylate.
What is the SMILES notation for ethyl 1-oxo-2,3-dihydropyrrolo[1,2-a]indole-2-carboxylate?
The canonical SMILES for ethyl 1-oxo-2,3-dihydropyrrolo[1,2-a]indole-2-carboxylate is CCOC(=O)C1Cc2cc3ccccc3n2C1=O.
What is the InChIKey of ethyl 1-oxo-2,3-dihydropyrrolo[1,2-a]indole-2-carboxylate?
The InChIKey is AVVYDQDHYRCHAH-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13NO3/c1-2-18-14(17)11-8-10-7-9-5-3-4-6-12(9)15(10)13(11)16/h3-7,11H,2,8H2,1H3.
What are the key properties of ethyl 1-oxo-2,3-dihydropyrrolo[1,2-a]indole-2-carboxylate?
ethyl 1-oxo-2,3-dihydropyrrolo[1,2-a]indole-2-carboxylate has a molecular weight of 243.26 g/mol, XLogP of 2.02, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 1-oxo-2,3-dihydropyrrolo[1,2-a]indole-2-carboxylate is sourced from PubChem (CID 67807991), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).