C24H26N2O3 — CID 139214163
ethyl 13-(4-methoxyphenyl)-11-methyl-1,11-diazatetracyclo[7.6.0.02,7.010,14]pentadeca-2,4,6,8-tetraene-14-carboxylate (PubChem CID 139214163) has the molecular formula C24H26N2O3 and a molecular weight of 390.48 g/mol. Its IUPAC name is ethyl 13-(4-methoxyphenyl)-11-methyl-1,11-diazatetracyclo[7.6.0.02,7.010,14]pentadeca-2,4,6,8-tetraene-14-carboxylate.
| Compound Name | ethyl 13-(4-methoxyphenyl)-11-methyl-1,11-diazatetracyclo[7.6.0.02,7.010,14]pentadeca-2,4,6,8-tetraene-14-carboxylate |
|---|---|
| PubChem CID | 139214163 |
| Molecular Formula | C24H26N2O3 |
| Molecular Weight | 390.48 g/mol |
| Exact Mass | 390.19 |
| IUPAC Name | ethyl 13-(4-methoxyphenyl)-11-methyl-1,11-diazatetracyclo[7.6.0.02,7.010,14]pentadeca-2,4,6,8-tetraene-14-carboxylate |
| SMILES | CCOC(=O)C12Cn3c(cc4ccccc43)C1N(C)CC2c1ccc(OC)cc1 |
| InChI | InChI=1S/C24H26N2O3/c1-4-29-23(27)24-15-26-20-8-6-5-7-17(20)13-21(26)22(24)25(2)14-19(24)16-9-11-18(28-3)12-10-16/h5-13,19,22H,4,14-15H2,1-3H3 |
| InChIKey | ZDFIVBOTALMMPD-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 43.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.48 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |