C22H32O5 — CID 11824965
4-[2-(1-adamantyl)-2-oxoethyl]-2,3,4-triethoxycyclobut-2-en-1-one (PubChem CID 11824965) has the molecular formula C22H32O5 and a molecular weight of 376.49 g/mol. Its IUPAC name is 4-[2-(1-adamantyl)-2-oxoethyl]-2,3,4-triethoxycyclobut-2-en-1-one.
| Compound Name | 4-[2-(1-adamantyl)-2-oxoethyl]-2,3,4-triethoxycyclobut-2-en-1-one |
|---|---|
| PubChem CID | 11824965 |
| Molecular Formula | C22H32O5 |
| Molecular Weight | 376.49 g/mol |
| Exact Mass | 376.22 |
| IUPAC Name | 4-[2-(1-adamantyl)-2-oxoethyl]-2,3,4-triethoxycyclobut-2-en-1-one |
| SMILES | CCOC1=C(OCC)C(CC(=O)C23CC4CC(CC(C4)C2)C3)(OCC)C1=O |
| InChI | InChI=1S/C22H32O5/c1-4-25-18-19(24)22(27-6-3,20(18)26-5-2)13-17(23)21-10-14-7-15(11-21)9-16(8-14)12-21/h14-16H,4-13H2,1-3H3 |
| InChIKey | MQFWJFLNRPVEKQ-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.49 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |