C11H8Cl4O — CID 98507891
(1R,2R,7S,8R)-2,4,5,7-tetrachlorotricyclo[6.2.1.02,7]undeca-4,9-dien-3-one (PubChem CID 98507891) has the molecular formula C11H8Cl4O and a molecular weight of 298.00 g/mol. Its IUPAC name is (1R,2R,7S,8R)-2,4,5,7-tetrachlorotricyclo[6.2.1.02,7]undeca-4,9-dien-3-one.
| Compound Name | (1R,2R,7S,8R)-2,4,5,7-tetrachlorotricyclo[6.2.1.02,7]undeca-4,9-dien-3-one |
|---|---|
| PubChem CID | 98507891 |
| Molecular Formula | C11H8Cl4O |
| Molecular Weight | 298.00 g/mol |
| Exact Mass | 295.93 |
| IUPAC Name | (1R,2R,7S,8R)-2,4,5,7-tetrachlorotricyclo[6.2.1.02,7]undeca-4,9-dien-3-one |
| SMILES | O=C1C(Cl)=C(Cl)C[C@]2(Cl)[C@H]3C=C[C@@H](C3)[C@@]12Cl |
| InChI | InChI=1S/C11H8Cl4O/c12-7-4-10(14)5-1-2-6(3-5)11(10,15)9(16)8(7)13/h1-2,5-6H,3-4H2/t5-,6-,10-,11+/m0/s1 |
| InChIKey | OALPGBHXUVVIAG-ZYLJIWOUSA-N |
| XLogP | 3.81 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.00 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|