C22H12Cl2N2O2 — CID 73229908
2,18-dichloro-3,17-dioxo-14-azahexacyclo[17.2.1.02,18.04,16.05,14.06,11]docosa-4,6,8,10,12,15,20-heptaene-15-carbonitrile (PubChem CID 73229908) has the molecular formula C22H12Cl2N2O2 and a molecular weight of 407.26 g/mol. Its IUPAC name is 2,18-dichloro-3,17-dioxo-14-azahexacyclo[17.2.1.02,18.04,16.05,14.06,11]docosa-4,6,8,10,12,15,20-heptaene-15-carbonitrile.
| Compound Name | 2,18-dichloro-3,17-dioxo-14-azahexacyclo[17.2.1.02,18.04,16.05,14.06,11]docosa-4,6,8,10,12,15,20-heptaene-15-carbonitrile |
|---|---|
| PubChem CID | 73229908 |
| Molecular Formula | C22H12Cl2N2O2 |
| Molecular Weight | 407.26 g/mol |
| Exact Mass | 406.03 |
| IUPAC Name | 2,18-dichloro-3,17-dioxo-14-azahexacyclo[17.2.1.02,18.04,16.05,14.06,11]docosa-4,6,8,10,12,15,20-heptaene-15-carbonitrile |
| SMILES | N#Cc1c2c(c3c4ccccc4ccn13)C(=O)C1(Cl)C3C=CC(C3)C1(Cl)C2=O |
| InChI | InChI=1S/C22H12Cl2N2O2/c23-21-12-5-6-13(9-12)22(21,24)20(28)17-16(19(21)27)15(10-25)26-8-7-11-3-1-2-4-14(11)18(17)26/h1-8,12-13H,9H2 |
| InChIKey | CWNRXDUTNQQMIA-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 62.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.26 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|