C11H6Cl4O2 — CID 98269507
(1R,2R,7R,8R)-2,4,5,7-tetrachlorotricyclo[6.2.1.02,7]undeca-4,9-diene-3,6-dione (PubChem CID 98269507) has the molecular formula C11H6Cl4O2 and a molecular weight of 311.98 g/mol. Its IUPAC name is (1R,2R,7R,8R)-2,4,5,7-tetrachlorotricyclo[6.2.1.02,7]undeca-4,9-diene-3,6-dione.
| Compound Name | (1R,2R,7R,8R)-2,4,5,7-tetrachlorotricyclo[6.2.1.02,7]undeca-4,9-diene-3,6-dione |
|---|---|
| PubChem CID | 98269507 |
| Molecular Formula | C11H6Cl4O2 |
| Molecular Weight | 311.98 g/mol |
| Exact Mass | 309.91 |
| IUPAC Name | (1R,2R,7R,8R)-2,4,5,7-tetrachlorotricyclo[6.2.1.02,7]undeca-4,9-diene-3,6-dione |
| SMILES | O=C1C(Cl)=C(Cl)C(=O)[C@]2(Cl)[C@H]3C=C[C@@H](C3)[C@@]12Cl |
| InChI | InChI=1S/C11H6Cl4O2/c12-6-7(13)9(17)11(15)5-2-1-4(3-5)10(11,14)8(6)16/h1-2,4-5H,3H2/t4-,5-,10+,11+/m0/s1 |
| InChIKey | IMTVCXFZYLBGDJ-XGMKGGNISA-N |
| XLogP | 2.99 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.98 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|