C10H8Cl4O — CID 98514888
(1S,2R,6S,7S)-2,4,5,6-tetrachlorotricyclo[5.2.1.02,6]dec-4-en-3-one (PubChem CID 98514888) has the molecular formula C10H8Cl4O and a molecular weight of 285.99 g/mol. Its IUPAC name is (1S,2R,6S,7S)-2,4,5,6-tetrachlorotricyclo[5.2.1.02,6]dec-4-en-3-one.
| Compound Name | (1S,2R,6S,7S)-2,4,5,6-tetrachlorotricyclo[5.2.1.02,6]dec-4-en-3-one |
|---|---|
| PubChem CID | 98514888 |
| Molecular Formula | C10H8Cl4O |
| Molecular Weight | 285.99 g/mol |
| Exact Mass | 283.93 |
| IUPAC Name | (1S,2R,6S,7S)-2,4,5,6-tetrachlorotricyclo[5.2.1.02,6]dec-4-en-3-one |
| SMILES | O=C1C(Cl)=C(Cl)[C@]2(Cl)[C@H]3CC[C@@H](C3)[C@@]12Cl |
| InChI | InChI=1S/C10H8Cl4O/c11-6-7(12)9(13)4-1-2-5(3-4)10(9,14)8(6)15/h4-5H,1-3H2/t4-,5-,9+,10+/m0/s1 |
| InChIKey | GWBBBAHMVVGLCO-MVTAHNJOSA-N |
| XLogP | 3.64 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.99 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|