C20H19Cl6NO2 — CID 100911203
(1R,2R,6R,7R)-4-(1-adamantylmethyl)-1,7,8,9,10,10-hexachloro-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione (PubChem CID 100911203) has the molecular formula C20H19Cl6NO2 and a molecular weight of 518.10 g/mol. Its IUPAC name is (1R,2R,6R,7R)-4-(1-adamantylmethyl)-1,7,8,9,10,10-hexachloro-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione.
| Compound Name | (1R,2R,6R,7R)-4-(1-adamantylmethyl)-1,7,8,9,10,10-hexachloro-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
|---|---|
| PubChem CID | 100911203 |
| Molecular Formula | C20H19Cl6NO2 |
| Molecular Weight | 518.10 g/mol |
| Exact Mass | 514.95 |
| IUPAC Name | (1R,2R,6R,7R)-4-(1-adamantylmethyl)-1,7,8,9,10,10-hexachloro-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
| SMILES | O=C1[C@H]2[C@H](C(=O)N1CC13CC4CC(CC(C4)C1)C3)[C@@]1(Cl)C(Cl)=C(Cl)[C@@]2(Cl)C1(Cl)Cl |
| InChI | InChI=1S/C20H19Cl6NO2/c21-13-14(22)19(24)12-11(18(13,23)20(19,25)26)15(28)27(16(12)29)7-17-4-8-1-9(5-17)3-10(2-8)6-17/h8-12H,1-7H2/t8?,9?,10?,11-,12-,17?,18-,19-/m1/s1 |
| InChIKey | OPLIFZZVNGREBB-GGTJRQKNSA-N |
| XLogP | 5.65 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.10 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|