C13H8Cl7NO3 — CID 99947850
(1R,2S,6S,7R)-1,7,8,9,10,10-hexachloro-4-[(Z)-3-chlorobut-2-enoxy]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione (PubChem CID 99947850) has the molecular formula C13H8Cl7NO3 and a molecular weight of 474.38 g/mol. Its IUPAC name is (1R,2S,6S,7R)-1,7,8,9,10,10-hexachloro-4-[(Z)-3-chlorobut-2-enoxy]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione.
| Compound Name | (1R,2S,6S,7R)-1,7,8,9,10,10-hexachloro-4-[(Z)-3-chlorobut-2-enoxy]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
|---|---|
| PubChem CID | 99947850 |
| Molecular Formula | C13H8Cl7NO3 |
| Molecular Weight | 474.38 g/mol |
| Exact Mass | 470.83 |
| IUPAC Name | (1R,2S,6S,7R)-1,7,8,9,10,10-hexachloro-4-[(Z)-3-chlorobut-2-enoxy]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
| SMILES | C/C(Cl)=C/CON1C(=O)[C@@H]2[C@@H](C1=O)[C@@]1(Cl)C(Cl)=C(Cl)[C@@]2(Cl)C1(Cl)Cl |
| InChI | InChI=1S/C13H8Cl7NO3/c1-4(14)2-3-24-21-9(22)5-6(10(21)23)12(18)8(16)7(15)11(5,17)13(12,19)20/h2,5-6H,3H2,1H3/b4-2-/t5-,6-,11+,12+/m0/s1 |
| InChIKey | WHYSOFNAFFTHLZ-ANLCXXPPSA-N |
| XLogP | 4.51 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.38 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|