C9H11Cl2NO — CID 139057123
(3S,6R)-1,7-dichloro-9-azatricyclo[4.3.1.03,7]decan-8-one (PubChem CID 139057123) has the molecular formula C9H11Cl2NO and a molecular weight of 220.10 g/mol. Its IUPAC name is (3S,6R)-1,7-dichloro-9-azatricyclo[4.3.1.03,7]decan-8-one.
| Compound Name | (3S,6R)-1,7-dichloro-9-azatricyclo[4.3.1.03,7]decan-8-one |
|---|---|
| PubChem CID | 139057123 |
| Molecular Formula | C9H11Cl2NO |
| Molecular Weight | 220.10 g/mol |
| Exact Mass | 219.02 |
| IUPAC Name | (3S,6R)-1,7-dichloro-9-azatricyclo[4.3.1.03,7]decan-8-one |
| SMILES | O=C1NC2(Cl)C[C@H]3CC[C@@H](C2)C13Cl |
| InChI | InChI=1S/C9H11Cl2NO/c10-8-3-5-1-2-6(4-8)9(5,11)7(13)12-8/h5-6H,1-4H2,(H,12,13)/t5-,6+,8?,9? |
| InChIKey | OCYTXWIAIHBPHL-HDTMMBBLSA-N |
| XLogP | 1.85 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.10 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|