C9H12N2O2 — CID 129387528
(1R,2R,4S)-spiro[bicyclo[2.2.1]heptane-2,5'-imidazolidine]-2',4'-dione (PubChem CID 129387528) has the molecular formula C9H12N2O2 and a molecular weight of 180.21 g/mol. Its IUPAC name is (1R,2R,4S)-spiro[bicyclo[2.2.1]heptane-2,5'-imidazolidine]-2',4'-dione.
| Compound Name | (1R,2R,4S)-spiro[bicyclo[2.2.1]heptane-2,5'-imidazolidine]-2',4'-dione |
|---|---|
| PubChem CID | 129387528 |
| Molecular Formula | C9H12N2O2 |
| Molecular Weight | 180.21 g/mol |
| Exact Mass | 180.09 |
| IUPAC Name | (1R,2R,4S)-spiro[bicyclo[2.2.1]heptane-2,5'-imidazolidine]-2',4'-dione |
| SMILES | O=C1NC(=O)[C@]2(C[C@H]3CC[C@@H]2C3)N1 |
| InChI | InChI=1S/C9H12N2O2/c12-7-9(11-8(13)10-7)4-5-1-2-6(9)3-5/h5-6H,1-4H2,(H2,10,11,12,13)/t5-,6+,9+/m0/s1 |
| InChIKey | WXMYOZGTBIDFEA-CCGCGBOQSA-N |
| XLogP | 0.38 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.21 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|