C11H16N2O4 — CID 99995843
methyl (5R,7S,9R)-7,9-dimethyl-2,4-dioxo-1,3-diazaspiro[4.4]nonane-7-carboxylate (PubChem CID 99995843) has the molecular formula C11H16N2O4 and a molecular weight of 240.26 g/mol. Its IUPAC name is methyl (5R,7S,9R)-7,9-dimethyl-2,4-dioxo-1,3-diazaspiro[4.4]nonane-7-carboxylate.
| Compound Name | methyl (5R,7S,9R)-7,9-dimethyl-2,4-dioxo-1,3-diazaspiro[4.4]nonane-7-carboxylate |
|---|---|
| PubChem CID | 99995843 |
| Molecular Formula | C11H16N2O4 |
| Molecular Weight | 240.26 g/mol |
| Exact Mass | 240.11 |
| IUPAC Name | methyl (5R,7S,9R)-7,9-dimethyl-2,4-dioxo-1,3-diazaspiro[4.4]nonane-7-carboxylate |
| SMILES | COC(=O)[C@@]1(C)C[C@@H](C)[C@@]2(C1)NC(=O)NC2=O |
| InChI | InChI=1S/C11H16N2O4/c1-6-4-10(2,8(15)17-3)5-11(6)7(14)12-9(16)13-11/h6H,4-5H2,1-3H3,(H2,12,13,14,16)/t6-,10+,11-/m1/s1 |
| InChIKey | IZCIFAGJCFJVBM-LIEZGIJOSA-N |
| XLogP | 0.17 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.26 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|