C36H24Cl24 — CID 139074910
(1S,2S,5S,6S,9R,10R,13R,14R)-1,6,7,8,9,14,15,16,17,17,18,18-dodecachloropentacyclo[12.2.1.16,9.02,13.05,10]octadeca-7,15-diene (PubChem CID 139074910) has the molecular formula C36H24Cl24 and a molecular weight of 1307.46 g/mol. Its IUPAC name is (1S,2S,5S,6S,9R,10R,13R,14R)-1,6,7,8,9,14,15,16,17,17,18,18-dodecachloropentacyclo[12.2.1.16,9.02,13.05,10]octadeca-7,15-diene.
| Compound Name | (1S,2S,5S,6S,9R,10R,13R,14R)-1,6,7,8,9,14,15,16,17,17,18,18-dodecachloropentacyclo[12.2.1.16,9.02,13.05,10]octadeca-7,15-diene |
|---|---|
| PubChem CID | 139074910 |
| Molecular Formula | C36H24Cl24 |
| Molecular Weight | 1307.46 g/mol |
| Exact Mass | 1295.44 |
| IUPAC Name | (1S,2S,5S,6S,9R,10R,13R,14R)-1,6,7,8,9,14,15,16,17,17,18,18-dodecachloropentacyclo[12.2.1.16,9.02,13.05,10]octadeca-7,15-diene |
| SMILES | ClC1=C(Cl)[C@]2(Cl)[C@@H]3CC[C@@H]4[C@H](CC[C@@H]3[C@@]1(Cl)C2(Cl)Cl)[C@]1(Cl)C(Cl)=C(Cl)[C@@]4(Cl)C1(Cl)Cl.ClC1=C(Cl)[C@]2(Cl)[C@@H]3CC[C@@H]4[C@H](CC[C@@H]3[C@@]1(Cl)C2(Cl)Cl)[C@]1(Cl)C(Cl)=C(Cl)[C@@]4(Cl)C1(Cl)Cl |
| InChI | InChI=1S/2C18H12Cl12/c2*19-9-10(20)15(25)7-3-4-8-6(2-1-5(7)13(9,23)17(15,27)28)14(24)11(21)12(22)16(8,26)18(14,29)30/h2*5-8H,1-4H2/t2*5-,6-,7+,8+,13-,14-,15+,16+ |
| InChIKey | WEUKWODDYNDYLZ-QQBZZRLVSA-N |
| XLogP | 19.43 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1307.46 |
| LogP ≤ 5 | 19.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|