C18H12Cl12 — CID 99650340
(1R,2S,4S,7R,8S)-1,8,9,10,11,11-hexachloro-4-[(1S,2R,4S)-1,4,5,6,7,7-hexachloro-2-bicyclo[2.2.1]hept-5-enyl]tricyclo[6.2.1.02,7]undec-9-ene (PubChem CID 99650340) has the molecular formula C18H12Cl12 and a molecular weight of 653.73 g/mol. Its IUPAC name is (1R,2S,4S,7R,8S)-1,8,9,10,11,11-hexachloro-4-[(1S,2R,4S)-1,4,5,6,7,7-hexachloro-2-bicyclo[2.2.1]hept-5-enyl]tricyclo[6.2.1.02,7]undec-9-ene.
| Compound Name | (1R,2S,4S,7R,8S)-1,8,9,10,11,11-hexachloro-4-[(1S,2R,4S)-1,4,5,6,7,7-hexachloro-2-bicyclo[2.2.1]hept-5-enyl]tricyclo[6.2.1.02,7]undec-9-ene |
|---|---|
| PubChem CID | 99650340 |
| Molecular Formula | C18H12Cl12 |
| Molecular Weight | 653.73 g/mol |
| Exact Mass | 647.72 |
| IUPAC Name | (1R,2S,4S,7R,8S)-1,8,9,10,11,11-hexachloro-4-[(1S,2R,4S)-1,4,5,6,7,7-hexachloro-2-bicyclo[2.2.1]hept-5-enyl]tricyclo[6.2.1.02,7]undec-9-ene |
| SMILES | ClC1=C(Cl)[C@@]2(Cl)C[C@H]([C@H]3CC[C@@H]4[C@H](C3)[C@@]3(Cl)C(Cl)=C(Cl)[C@]4(Cl)C3(Cl)Cl)[C@@]1(Cl)C2(Cl)Cl |
| InChI | InChI=1S/C18H12Cl12/c19-9-10(20)16(26)8(4-13(9,23)17(16,27)28)5-1-2-6-7(3-5)15(25)12(22)11(21)14(6,24)18(15,29)30/h5-8H,1-4H2/t5-,6+,7-,8+,13-,14-,15+,16-/m0/s1 |
| InChIKey | RFCMCABFBMLNQF-SASCAXKDSA-N |
| XLogP | 9.72 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.73 |
| LogP ≤ 5 | 9.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|