C16H12Cl8 — CID 89234857
5,6,7,8,13,14,15,16-octachloropentacyclo[10.4.0.04,9.05,8.013,16]hexadeca-6,14-diene (PubChem CID 89234857) has the molecular formula C16H12Cl8 and a molecular weight of 487.90 g/mol. Its IUPAC name is 5,6,7,8,13,14,15,16-octachloropentacyclo[10.4.0.04,9.05,8.013,16]hexadeca-6,14-diene.
| Compound Name | 5,6,7,8,13,14,15,16-octachloropentacyclo[10.4.0.04,9.05,8.013,16]hexadeca-6,14-diene |
|---|---|
| PubChem CID | 89234857 |
| Molecular Formula | C16H12Cl8 |
| Molecular Weight | 487.90 g/mol |
| Exact Mass | 483.84 |
| IUPAC Name | 5,6,7,8,13,14,15,16-octachloropentacyclo[10.4.0.04,9.05,8.013,16]hexadeca-6,14-diene |
| SMILES | ClC1=C(Cl)C2(Cl)C3CCC4C(CCC3C12Cl)C1(Cl)C(Cl)=C(Cl)C41Cl |
| InChI | InChI=1S/C16H12Cl8/c17-9-10(18)15(23)7-3-4-8-6(2-1-5(7)13(9,15)21)14(22)11(19)12(20)16(8,14)24/h5-8H,1-4H2 |
| InChIKey | PQIJMMYVDSYAOB-UHFFFAOYSA-N |
| XLogP | 7.37 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.90 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|