C8H4Cl6O — CID 6432407
1,4,5,6,7,7-hexachlorobicyclo[2.2.1]hept-5-ene-2-carbaldehyde (PubChem CID 6432407) has the molecular formula C8H4Cl6O and a molecular weight of 328.84 g/mol. Its IUPAC name is 1,4,5,6,7,7-hexachlorobicyclo[2.2.1]hept-5-ene-2-carbaldehyde.
| Compound Name | 1,4,5,6,7,7-hexachlorobicyclo[2.2.1]hept-5-ene-2-carbaldehyde |
|---|---|
| PubChem CID | 6432407 |
| Molecular Formula | C8H4Cl6O |
| Molecular Weight | 328.84 g/mol |
| Exact Mass | 325.84 |
| IUPAC Name | 1,4,5,6,7,7-hexachlorobicyclo[2.2.1]hept-5-ene-2-carbaldehyde |
| SMILES | O=CC1CC2(Cl)C(Cl)=C(Cl)C1(Cl)C2(Cl)Cl |
| InChI | InChI=1S/C8H4Cl6O/c9-4-5(10)7(12)3(2-15)1-6(4,11)8(7,13)14/h2-3H,1H2 |
| InChIKey | JYYQMATWCIEKAT-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.84 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|