C19H15NO2 — CID 11403529
(1R,15S)-4-ethyl-4-azapentacyclo[13.2.1.02,14.03,11.05,10]octadeca-2(14),3(11),5,7,9,16-hexaene-12,13-dione (PubChem CID 11403529) has the molecular formula C19H15NO2 and a molecular weight of 289.33 g/mol. Its IUPAC name is (1R,15S)-4-ethyl-4-azapentacyclo[13.2.1.02,14.03,11.05,10]octadeca-2(14),3(11),5,7,9,16-hexaene-12,13-dione.
| Compound Name | (1R,15S)-4-ethyl-4-azapentacyclo[13.2.1.02,14.03,11.05,10]octadeca-2(14),3(11),5,7,9,16-hexaene-12,13-dione |
|---|---|
| PubChem CID | 11403529 |
| Molecular Formula | C19H15NO2 |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.11 |
| IUPAC Name | (1R,15S)-4-ethyl-4-azapentacyclo[13.2.1.02,14.03,11.05,10]octadeca-2(14),3(11),5,7,9,16-hexaene-12,13-dione |
| SMILES | CCn1c2c(c3ccccc31)C(=O)C(=O)C1=C2[C@H]2C=C[C@@H]1C2 |
| InChI | InChI=1S/C19H15NO2/c1-2-20-13-6-4-3-5-12(13)16-17(20)14-10-7-8-11(9-10)15(14)18(21)19(16)22/h3-8,10-11H,2,9H2,1H3/t10-,11+/m0/s1 |
| InChIKey | OZPDINUZGHIOBJ-WDEREUQCSA-N |
| XLogP | 3.39 |
| TPSA | 39.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|