C23H20N2O2 — CID 91294829
(1S,7R)-4-(9-ethylcarbazol-2-yl)-4-azatricyclo[5.2.1.02,6]deca-2,5,8-triene-3,5-diol (PubChem CID 91294829) has the molecular formula C23H20N2O2 and a molecular weight of 356.43 g/mol. Its IUPAC name is (1S,7R)-4-(9-ethylcarbazol-2-yl)-4-azatricyclo[5.2.1.02,6]deca-2,5,8-triene-3,5-diol.
| Compound Name | (1S,7R)-4-(9-ethylcarbazol-2-yl)-4-azatricyclo[5.2.1.02,6]deca-2,5,8-triene-3,5-diol |
|---|---|
| PubChem CID | 91294829 |
| Molecular Formula | C23H20N2O2 |
| Molecular Weight | 356.43 g/mol |
| Exact Mass | 356.15 |
| IUPAC Name | (1S,7R)-4-(9-ethylcarbazol-2-yl)-4-azatricyclo[5.2.1.02,6]deca-2,5,8-triene-3,5-diol |
| SMILES | CCn1c2ccccc2c2ccc(-n3c(O)c4c(c3O)[C@H]3C=C[C@@H]4C3)cc21 |
| InChI | InChI=1S/C23H20N2O2/c1-2-24-18-6-4-3-5-16(18)17-10-9-15(12-19(17)24)25-22(26)20-13-7-8-14(11-13)21(20)23(25)27/h3-10,12-14,26-27H,2,11H2,1H3/t13-,14+ |
| InChIKey | ZFPACYFYEXROAS-OKILXGFUSA-N |
| XLogP | 5.16 |
| TPSA | 50.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.43 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|