C19H17N — CID 142416237
18-ethyl-18-azapentacyclo[9.7.0.02,8.03,5.012,17]octadeca-1(11),2(8),6,9,12,14,16-heptaene (PubChem CID 142416237) has the molecular formula C19H17N and a molecular weight of 259.35 g/mol. Its IUPAC name is 18-ethyl-18-azapentacyclo[9.7.0.02,8.03,5.012,17]octadeca-1(11),2(8),6,9,12,14,16-heptaene.
| Compound Name | 18-ethyl-18-azapentacyclo[9.7.0.02,8.03,5.012,17]octadeca-1(11),2(8),6,9,12,14,16-heptaene |
|---|---|
| PubChem CID | 142416237 |
| Molecular Formula | C19H17N |
| Molecular Weight | 259.35 g/mol |
| Exact Mass | 259.14 |
| IUPAC Name | 18-ethyl-18-azapentacyclo[9.7.0.02,8.03,5.012,17]octadeca-1(11),2(8),6,9,12,14,16-heptaene |
| SMILES | CCn1c2ccccc2c2ccc3c(c21)C1CC1C=C3 |
| InChI | InChI=1S/C19H17N/c1-2-20-17-6-4-3-5-14(17)15-10-9-12-7-8-13-11-16(13)18(12)19(15)20/h3-10,13,16H,2,11H2,1H3 |
| InChIKey | CQGNDDMCBQOGQP-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.35 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |