C23H21NO3 — CID 90723193
4-[3-[(4-methylphenyl)methoxy]phenyl]-4-azatricyclo[5.2.1.02,6]deca-2,5,8-triene-3,5-diol (PubChem CID 90723193) has the molecular formula C23H21NO3 and a molecular weight of 359.43 g/mol. Its IUPAC name is 4-[3-[(4-methylphenyl)methoxy]phenyl]-4-azatricyclo[5.2.1.02,6]deca-2,5,8-triene-3,5-diol.
| Compound Name | 4-[3-[(4-methylphenyl)methoxy]phenyl]-4-azatricyclo[5.2.1.02,6]deca-2,5,8-triene-3,5-diol |
|---|---|
| PubChem CID | 90723193 |
| Molecular Formula | C23H21NO3 |
| Molecular Weight | 359.43 g/mol |
| Exact Mass | 359.15 |
| IUPAC Name | 4-[3-[(4-methylphenyl)methoxy]phenyl]-4-azatricyclo[5.2.1.02,6]deca-2,5,8-triene-3,5-diol |
| SMILES | Cc1ccc(COc2cccc(-n3c(O)c4c(c3O)C3C=CC4C3)c2)cc1 |
| InChI | InChI=1S/C23H21NO3/c1-14-5-7-15(8-6-14)13-27-19-4-2-3-18(12-19)24-22(25)20-16-9-10-17(11-16)21(20)23(24)26/h2-10,12,16-17,25-26H,11,13H2,1H3 |
| InChIKey | BNRNBJIHWWEOSA-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 54.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.43 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|