C14H18NP — CID 126497398
tert-butyl-cyclopenta-2,4-dien-1-yl-pyridin-2-ylphosphane (PubChem CID 126497398) has the molecular formula C14H18NP and a molecular weight of 231.28 g/mol. Its IUPAC name is tert-butyl-cyclopenta-2,4-dien-1-yl-pyridin-2-ylphosphane.
| Compound Name | tert-butyl-cyclopenta-2,4-dien-1-yl-pyridin-2-ylphosphane |
|---|---|
| PubChem CID | 126497398 |
| Molecular Formula | C14H18NP |
| Molecular Weight | 231.28 g/mol |
| Exact Mass | 231.12 |
| IUPAC Name | tert-butyl-cyclopenta-2,4-dien-1-yl-pyridin-2-ylphosphane |
| SMILES | CC(C)(C)P(c1ccccn1)C1C=CC=C1 |
| InChI | InChI=1S/C14H18NP/c1-14(2,3)16(12-8-4-5-9-12)13-10-6-7-11-15-13/h4-12H,1-3H3 |
| InChIKey | YIXKQOQTOULEBX-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.28 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|