C25H32N2P2 — CID 126492794
tert-butyl-[2-[[tert-butyl(pyridin-2-yl)phosphanyl]methyl]phenyl]-pyridin-2-ylphosphane (PubChem CID 126492794) has the molecular formula C25H32N2P2 and a molecular weight of 422.49 g/mol. Its IUPAC name is tert-butyl-[2-[[tert-butyl(pyridin-2-yl)phosphanyl]methyl]phenyl]-pyridin-2-ylphosphane.
| Compound Name | tert-butyl-[2-[[tert-butyl(pyridin-2-yl)phosphanyl]methyl]phenyl]-pyridin-2-ylphosphane |
|---|---|
| PubChem CID | 126492794 |
| Molecular Formula | C25H32N2P2 |
| Molecular Weight | 422.49 g/mol |
| Exact Mass | 422.20 |
| IUPAC Name | tert-butyl-[2-[[tert-butyl(pyridin-2-yl)phosphanyl]methyl]phenyl]-pyridin-2-ylphosphane |
| SMILES | CC(C)(C)P(Cc1ccccc1P(c1ccccn1)C(C)(C)C)c1ccccn1 |
| InChI | InChI=1S/C25H32N2P2/c1-24(2,3)28(22-15-9-11-17-26-22)19-20-13-7-8-14-21(20)29(25(4,5)6)23-16-10-12-18-27-23/h7-18H,19H2,1-6H3 |
| InChIKey | YYDJFFSNSAJYAO-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.49 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|