About bromogold;bis(2-dipyridin-2-ylphosphanylethyl(dipyridin-2-yl)phosphane)
bromogold;bis(2-dipyridin-2-ylphosphanylethyl(dipyridin-2-yl)phosphane) (PubChem CID 88596830) has the molecular formula C44H38AuBrN8P4-2
and a molecular weight of 1079.61 g/mol. Its IUPAC name is bromogold;bis(2-dipyridin-2-ylphosphanylethyl(dipyridin-2-yl)phosphane).
Molecular Properties
| Compound Name | bromogold;bis(2-dipyridin-2-ylphosphanylethyl(dipyridin-2-yl)phosphane) |
| PubChem CID | 88596830 |
| Molecular Formula | C44H38AuBrN8P4-2 |
| Molecular Weight | 1079.61 g/mol |
| Exact Mass | 1078.10 |
| IUPAC Name | bromogold;bis(2-dipyridin-2-ylphosphanylethyl(dipyridin-2-yl)phosphane) |
| SMILES | Br[Au].c1ccc(P([CH-]CP(c2ccccn2)c2ccccn2)c2ccccn2)nc1.c1ccc(P([CH-]CP(c2ccccn2)c2ccccn2)c2ccccn2)nc1 |
| InChI | InChI=1S/2C22H19N4P2.Au.BrH/c2*1-5-13-23-19(9-1)27(20-10-2-6-14-24-20)17-18-28(21-11-3-7-15-25-21)22-12-4-8-16-26-22;;/h2*1-17H,18H2;;1H/q2*-1;+1;/p-1 |
| InChIKey | ZIBIHGVTEXHEAX-UHFFFAOYSA-M |
| XLogP | 6.83 |
| TPSA | 103.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 58 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 1079.61 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze bromogold;bis(2-dipyridin-2-ylphosphanylethyl(dipyridin-2-yl)phosphane) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bromogold;bis(2-dipyridin-2-ylphosphanylethyl(dipyridin-2-yl)phosphane)?
The IUPAC name of bromogold;bis(2-dipyridin-2-ylphosphanylethyl(dipyridin-2-yl)phosphane) (CID 88596830) is bromogold;bis(2-dipyridin-2-ylphosphanylethyl(dipyridin-2-yl)phosphane).
What is the SMILES notation for bromogold;bis(2-dipyridin-2-ylphosphanylethyl(dipyridin-2-yl)phosphane)?
The canonical SMILES for bromogold;bis(2-dipyridin-2-ylphosphanylethyl(dipyridin-2-yl)phosphane) is Br[Au].c1ccc(P([CH-]CP(c2ccccn2)c2ccccn2)c2ccccn2)nc1.c1ccc(P([CH-]CP(c2ccccn2)c2ccccn2)c2ccccn2)nc1.
What is the InChIKey of bromogold;bis(2-dipyridin-2-ylphosphanylethyl(dipyridin-2-yl)phosphane)?
The InChIKey is ZIBIHGVTEXHEAX-UHFFFAOYSA-M. The full InChI is InChI=1S/2C22H19N4P2.Au.BrH/c2*1-5-13-23-19(9-1)27(20-10-2-6-14-24-20)17-18-28(21-11-3-7-15-25-21)22-12-4-8-16-26-22;;/h2*1-17H,18H2;;1H/q2*-1;+1;/p-1.
What are the key properties of bromogold;bis(2-dipyridin-2-ylphosphanylethyl(dipyridin-2-yl)phosphane)?
bromogold;bis(2-dipyridin-2-ylphosphanylethyl(dipyridin-2-yl)phosphane) has a molecular weight of 1079.61 g/mol, XLogP of 6.83, 14 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for bromogold;bis(2-dipyridin-2-ylphosphanylethyl(dipyridin-2-yl)phosphane) is sourced from PubChem (CID 88596830), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).