C26H34N2P2 — CID 159836265
tert-butyl-[[3-[[tert-butyl(pyridin-2-yl)phosphanyl]methyl]phenyl]methyl]-pyridin-2-ylphosphane (PubChem CID 159836265) has the molecular formula C26H34N2P2 and a molecular weight of 436.52 g/mol. Its IUPAC name is tert-butyl-[[3-[[tert-butyl(pyridin-2-yl)phosphanyl]methyl]phenyl]methyl]-pyridin-2-ylphosphane.
| Compound Name | tert-butyl-[[3-[[tert-butyl(pyridin-2-yl)phosphanyl]methyl]phenyl]methyl]-pyridin-2-ylphosphane |
|---|---|
| PubChem CID | 159836265 |
| Molecular Formula | C26H34N2P2 |
| Molecular Weight | 436.52 g/mol |
| Exact Mass | 436.22 |
| IUPAC Name | tert-butyl-[[3-[[tert-butyl(pyridin-2-yl)phosphanyl]methyl]phenyl]methyl]-pyridin-2-ylphosphane |
| SMILES | CC(C)(C)P(Cc1cccc(CP(c2ccccn2)C(C)(C)C)c1)c1ccccn1 |
| InChI | InChI=1S/C26H34N2P2/c1-25(2,3)29(23-14-7-9-16-27-23)19-21-12-11-13-22(18-21)20-30(26(4,5)6)24-15-8-10-17-28-24/h7-18H,19-20H2,1-6H3 |
| InChIKey | NOCPQWNANNMEND-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.52 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|