C14H25OP — CID 174784035
ditert-butyl-(5-methoxycyclopenta-1,3-dien-1-yl)phosphane (PubChem CID 174784035) has the molecular formula C14H25OP and a molecular weight of 240.33 g/mol. Its IUPAC name is ditert-butyl-(5-methoxycyclopenta-1,3-dien-1-yl)phosphane.
| Compound Name | ditert-butyl-(5-methoxycyclopenta-1,3-dien-1-yl)phosphane |
|---|---|
| PubChem CID | 174784035 |
| Molecular Formula | C14H25OP |
| Molecular Weight | 240.33 g/mol |
| Exact Mass | 240.16 |
| IUPAC Name | ditert-butyl-(5-methoxycyclopenta-1,3-dien-1-yl)phosphane |
| SMILES | COC1C=CC=C1P(C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C14H25OP/c1-13(2,3)16(14(4,5)6)12-10-8-9-11(12)15-7/h8-11H,1-7H3 |
| InChIKey | SBZJDLZRGBQKFJ-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.33 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|