C11H14O2 — CID 143029223
6-ethyl-5-methoxycyclohepta-1,3,6-triene-1-carbaldehyde (PubChem CID 143029223) has the molecular formula C11H14O2 and a molecular weight of 178.23 g/mol. Its IUPAC name is 6-ethyl-5-methoxycyclohepta-1,3,6-triene-1-carbaldehyde.
| Compound Name | 6-ethyl-5-methoxycyclohepta-1,3,6-triene-1-carbaldehyde |
|---|---|
| PubChem CID | 143029223 |
| Molecular Formula | C11H14O2 |
| Molecular Weight | 178.23 g/mol |
| Exact Mass | 178.10 |
| IUPAC Name | 6-ethyl-5-methoxycyclohepta-1,3,6-triene-1-carbaldehyde |
| SMILES | CCC1=CC(C=O)=CC=CC1OC |
| InChI | InChI=1S/C11H14O2/c1-3-10-7-9(8-12)5-4-6-11(10)13-2/h4-8,11H,3H2,1-2H3 |
| InChIKey | IXEOWCFMBSDJCP-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.23 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|