C9H8O2 — CID 142377844
cyclohepta-1,3,5-triene-1,3-dicarbaldehyde (PubChem CID 142377844) has the molecular formula C9H8O2 and a molecular weight of 148.16 g/mol. Its IUPAC name is cyclohepta-1,3,5-triene-1,3-dicarbaldehyde.
| Compound Name | cyclohepta-1,3,5-triene-1,3-dicarbaldehyde |
|---|---|
| PubChem CID | 142377844 |
| Molecular Formula | C9H8O2 |
| Molecular Weight | 148.16 g/mol |
| Exact Mass | 148.05 |
| IUPAC Name | cyclohepta-1,3,5-triene-1,3-dicarbaldehyde |
| SMILES | O=CC1=CC=CCC(C=O)=C1 |
| InChI | InChI=1S/C9H8O2/c10-6-8-3-1-2-4-9(5-8)7-11/h1-3,5-7H,4H2 |
| InChIKey | ZXGUGOOVZISWRF-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.16 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|