C10H11NO — CID 176526109
(5Z,7E)-8-amino-3-methylcycloocta-1,2,5,7-tetraene-1-carbaldehyde (PubChem CID 176526109) has the molecular formula C10H11NO and a molecular weight of 161.20 g/mol. Its IUPAC name is (5Z,7E)-8-amino-3-methylcycloocta-1,2,5,7-tetraene-1-carbaldehyde.
| Compound Name | (5Z,7E)-8-amino-3-methylcycloocta-1,2,5,7-tetraene-1-carbaldehyde |
|---|---|
| PubChem CID | 176526109 |
| Molecular Formula | C10H11NO |
| Molecular Weight | 161.20 g/mol |
| Exact Mass | 161.08 |
| IUPAC Name | (5Z,7E)-8-amino-3-methylcycloocta-1,2,5,7-tetraene-1-carbaldehyde |
| SMILES | CC1=C=C(C=O)/C(N)=C\C=C/C1 |
| InChI | InChI=1S/C10H11NO/c1-8-4-2-3-5-10(11)9(6-8)7-12/h2-3,5,7H,4,11H2,1H3/b3-2-,10-5+ |
| InChIKey | KTZDSDFEBYWLGH-IPIUBCRSSA-N |
| XLogP | 1.46 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.20 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|