C9H11NOS — CID 143300835
7-amino-3-methyl-3-sulfanylcyclohepta-1,4,6-triene-1-carbaldehyde (PubChem CID 143300835) has the molecular formula C9H11NOS and a molecular weight of 181.26 g/mol. Its IUPAC name is 7-amino-3-methyl-3-sulfanylcyclohepta-1,4,6-triene-1-carbaldehyde.
| Compound Name | 7-amino-3-methyl-3-sulfanylcyclohepta-1,4,6-triene-1-carbaldehyde |
|---|---|
| PubChem CID | 143300835 |
| Molecular Formula | C9H11NOS |
| Molecular Weight | 181.26 g/mol |
| Exact Mass | 181.06 |
| IUPAC Name | 7-amino-3-methyl-3-sulfanylcyclohepta-1,4,6-triene-1-carbaldehyde |
| SMILES | CC1(S)C=CC=C(N)C(C=O)=C1 |
| InChI | InChI=1S/C9H11NOS/c1-9(12)4-2-3-8(10)7(5-9)6-11/h2-6,12H,10H2,1H3 |
| InChIKey | KTIDOKLXMQEYMW-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.26 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|