About 8-amino-2,2-dimethyl-3H-imidazo[1,2-a]pyridine-3-carbaldehyde
8-amino-2,2-dimethyl-3H-imidazo[1,2-a]pyridine-3-carbaldehyde (PubChem CID 142650775) has the molecular formula C10H13N3O
and a molecular weight of 191.23 g/mol. Its IUPAC name is 8-amino-2,2-dimethyl-3H-imidazo[1,2-a]pyridine-3-carbaldehyde.
Molecular Properties
| Compound Name | 8-amino-2,2-dimethyl-3H-imidazo[1,2-a]pyridine-3-carbaldehyde |
| PubChem CID | 142650775 |
| Molecular Formula | C10H13N3O |
| Molecular Weight | 191.23 g/mol |
| Exact Mass | 191.11 |
| IUPAC Name | 8-amino-2,2-dimethyl-3H-imidazo[1,2-a]pyridine-3-carbaldehyde |
| SMILES | CC1(C)N=C2C(N)=CC=CN2C1C=O |
| InChI | InChI=1S/C10H13N3O/c1-10(2)8(6-14)13-5-3-4-7(11)9(13)12-10/h3-6,8H,11H2,1-2H3 |
| InChIKey | JJYUNTBSKAUVHG-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 58.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.23 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 8-amino-2,2-dimethyl-3H-imidazo[1,2-a]pyridine-3-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-amino-2,2-dimethyl-3H-imidazo[1,2-a]pyridine-3-carbaldehyde?
The IUPAC name of 8-amino-2,2-dimethyl-3H-imidazo[1,2-a]pyridine-3-carbaldehyde (CID 142650775) is 8-amino-2,2-dimethyl-3H-imidazo[1,2-a]pyridine-3-carbaldehyde.
What is the SMILES notation for 8-amino-2,2-dimethyl-3H-imidazo[1,2-a]pyridine-3-carbaldehyde?
The canonical SMILES for 8-amino-2,2-dimethyl-3H-imidazo[1,2-a]pyridine-3-carbaldehyde is CC1(C)N=C2C(N)=CC=CN2C1C=O.
What is the InChIKey of 8-amino-2,2-dimethyl-3H-imidazo[1,2-a]pyridine-3-carbaldehyde?
The InChIKey is JJYUNTBSKAUVHG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13N3O/c1-10(2)8(6-14)13-5-3-4-7(11)9(13)12-10/h3-6,8H,11H2,1-2H3.
What are the key properties of 8-amino-2,2-dimethyl-3H-imidazo[1,2-a]pyridine-3-carbaldehyde?
8-amino-2,2-dimethyl-3H-imidazo[1,2-a]pyridine-3-carbaldehyde has a molecular weight of 191.23 g/mol, XLogP of 0.42, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 8-amino-2,2-dimethyl-3H-imidazo[1,2-a]pyridine-3-carbaldehyde is sourced from PubChem (CID 142650775), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).