C8H10ClNO2S — CID 130997130
(2S,5R,6S)-6-chloro-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carbaldehyde (PubChem CID 130997130) has the molecular formula C8H10ClNO2S and a molecular weight of 219.69 g/mol. Its IUPAC name is (2S,5R,6S)-6-chloro-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carbaldehyde.
| Compound Name | (2S,5R,6S)-6-chloro-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carbaldehyde |
|---|---|
| PubChem CID | 130997130 |
| Molecular Formula | C8H10ClNO2S |
| Molecular Weight | 219.69 g/mol |
| Exact Mass | 219.01 |
| IUPAC Name | (2S,5R,6S)-6-chloro-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carbaldehyde |
| SMILES | CC1(C)S[C@@H]2[C@@H](Cl)C(=O)N2[C@H]1C=O |
| InChI | InChI=1S/C8H10ClNO2S/c1-8(2)4(3-11)10-6(12)5(9)7(10)13-8/h3-5,7H,1-2H3/t4-,5-,7+/m0/s1 |
| InChIKey | ISXMIFRXHPCCKR-KZLJYQGOSA-N |
| XLogP | 0.86 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.69 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|