C9H12N2O4S — CID 118501610
(3S,7R,7aR)-3-formyl-2,2-dimethyl-5-oxo-3,6,7,7a-tetrahydroimidazo[5,1-b][1,3]thiazole-7-carboxylic acid (PubChem CID 118501610) has the molecular formula C9H12N2O4S and a molecular weight of 244.27 g/mol. Its IUPAC name is (3S,7R,7aR)-3-formyl-2,2-dimethyl-5-oxo-3,6,7,7a-tetrahydroimidazo[5,1-b][1,3]thiazole-7-carboxylic acid.
| Compound Name | (3S,7R,7aR)-3-formyl-2,2-dimethyl-5-oxo-3,6,7,7a-tetrahydroimidazo[5,1-b][1,3]thiazole-7-carboxylic acid |
|---|---|
| PubChem CID | 118501610 |
| Molecular Formula | C9H12N2O4S |
| Molecular Weight | 244.27 g/mol |
| Exact Mass | 244.05 |
| IUPAC Name | (3S,7R,7aR)-3-formyl-2,2-dimethyl-5-oxo-3,6,7,7a-tetrahydroimidazo[5,1-b][1,3]thiazole-7-carboxylic acid |
| SMILES | CC1(C)S[C@@H]2[C@@H](C(=O)O)NC(=O)N2[C@H]1C=O |
| InChI | InChI=1S/C9H12N2O4S/c1-9(2)4(3-12)11-6(16-9)5(7(13)14)10-8(11)15/h3-6H,1-2H3,(H,10,15)(H,13,14)/t4-,5-,6+/m0/s1 |
| InChIKey | GVOBFSLOKNPIQX-HCWXCVPCSA-N |
| XLogP | -0.12 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.27 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|