C13H18ClNO6S — CID 70431603
propoxycarbonyloxymethyl (2S,5R,6R)-6-chloro-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate (PubChem CID 70431603) has the molecular formula C13H18ClNO6S and a molecular weight of 351.81 g/mol. Its IUPAC name is propoxycarbonyloxymethyl (2S,5R,6R)-6-chloro-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate.
| Compound Name | propoxycarbonyloxymethyl (2S,5R,6R)-6-chloro-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
|---|---|
| PubChem CID | 70431603 |
| Molecular Formula | C13H18ClNO6S |
| Molecular Weight | 351.81 g/mol |
| Exact Mass | 351.05 |
| IUPAC Name | propoxycarbonyloxymethyl (2S,5R,6R)-6-chloro-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
| SMILES | CCCOC(=O)OCOC(=O)[C@@H]1N2C(=O)[C@@H](Cl)[C@H]2SC1(C)C |
| InChI | InChI=1S/C13H18ClNO6S/c1-4-5-19-12(18)21-6-20-11(17)8-13(2,3)22-10-7(14)9(16)15(8)10/h7-8,10H,4-6H2,1-3H3/t7-,8+,10-/m1/s1 |
| InChIKey | XZLDZCXYFUVMLJ-KHQFGBGNSA-N |
| XLogP | 1.72 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.81 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|