C15H22FNO5S — CID 70432054
hexanoyloxymethyl (2S,5R,6R)-6-fluoro-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate (PubChem CID 70432054) has the molecular formula C15H22FNO5S and a molecular weight of 347.41 g/mol. Its IUPAC name is hexanoyloxymethyl (2S,5R,6R)-6-fluoro-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate.
| Compound Name | hexanoyloxymethyl (2S,5R,6R)-6-fluoro-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
|---|---|
| PubChem CID | 70432054 |
| Molecular Formula | C15H22FNO5S |
| Molecular Weight | 347.41 g/mol |
| Exact Mass | 347.12 |
| IUPAC Name | hexanoyloxymethyl (2S,5R,6R)-6-fluoro-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
| SMILES | CCCCCC(=O)OCOC(=O)[C@@H]1N2C(=O)[C@@H](F)[C@H]2SC1(C)C |
| InChI | InChI=1S/C15H22FNO5S/c1-4-5-6-7-9(18)21-8-22-14(20)11-15(2,3)23-13-10(16)12(19)17(11)13/h10-11,13H,4-8H2,1-3H3/t10-,11+,13-/m1/s1 |
| InChIKey | WSJBBXPVNFAZOE-NTZNESFSSA-N |
| XLogP | 2.01 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.41 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|