C17H25NO9S — CID 22814943
hexanoyloxymethyl (2S,3R,5R)-3-(acetyloxymethyl)-3-methyl-4,4,7-trioxo-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate (PubChem CID 22814943) has the molecular formula C17H25NO9S and a molecular weight of 419.45 g/mol. Its IUPAC name is hexanoyloxymethyl (2S,3R,5R)-3-(acetyloxymethyl)-3-methyl-4,4,7-trioxo-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate.
| Compound Name | hexanoyloxymethyl (2S,3R,5R)-3-(acetyloxymethyl)-3-methyl-4,4,7-trioxo-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
|---|---|
| PubChem CID | 22814943 |
| Molecular Formula | C17H25NO9S |
| Molecular Weight | 419.45 g/mol |
| Exact Mass | 419.13 |
| IUPAC Name | hexanoyloxymethyl (2S,3R,5R)-3-(acetyloxymethyl)-3-methyl-4,4,7-trioxo-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
| SMILES | CCCCCC(=O)OCOC(=O)[C@@H]1N2C(=O)C[C@H]2S(=O)(=O)[C@@]1(C)COC(C)=O |
| InChI | InChI=1S/C17H25NO9S/c1-4-5-6-7-14(21)26-10-27-16(22)15-17(3,9-25-11(2)19)28(23,24)13-8-12(20)18(13)15/h13,15H,4-10H2,1-3H3/t13-,15+,17+/m1/s1 |
| InChIKey | BLYDQARCLKDZPH-KMFMINBZSA-N |
| XLogP | 0.29 |
| TPSA | 133.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.45 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|