C15H21NO9S — CID 13343977
6-[[(2S,5R)-3,3-dimethyl-4,4,7-trioxo-4lambda6-thia-1-azabicyclo[3.2.0]heptane-2-carbonyl]oxymethoxy]-6-oxohexanoic acid (PubChem CID 13343977) has the molecular formula C15H21NO9S and a molecular weight of 391.40 g/mol. Its IUPAC name is 6-[[(2S,5R)-3,3-dimethyl-4,4,7-trioxo-4lambda6-thia-1-azabicyclo[3.2.0]heptane-2-carbonyl]oxymethoxy]-6-oxohexanoic acid.
| Compound Name | 6-[[(2S,5R)-3,3-dimethyl-4,4,7-trioxo-4lambda6-thia-1-azabicyclo[3.2.0]heptane-2-carbonyl]oxymethoxy]-6-oxohexanoic acid |
|---|---|
| PubChem CID | 13343977 |
| Molecular Formula | C15H21NO9S |
| Molecular Weight | 391.40 g/mol |
| Exact Mass | 391.09 |
| IUPAC Name | 6-[[(2S,5R)-3,3-dimethyl-4,4,7-trioxo-4lambda6-thia-1-azabicyclo[3.2.0]heptane-2-carbonyl]oxymethoxy]-6-oxohexanoic acid |
| SMILES | CC1(C)[C@H](C(=O)OCOC(=O)CCCCC(=O)O)N2C(=O)C[C@H]2S1(=O)=O |
| InChI | InChI=1S/C15H21NO9S/c1-15(2)13(16-9(17)7-10(16)26(15,22)23)14(21)25-8-24-12(20)6-4-3-5-11(18)19/h10,13H,3-8H2,1-2H3,(H,18,19)/t10-,13+/m1/s1 |
| InChIKey | MCYLPMDJNANJCA-MFKMUULPSA-N |
| XLogP | -0.19 |
| TPSA | 144.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.40 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|