C26H28N2O14S2 — CID 70471233
bis[[(2S,5R)-3,3-dimethyl-4,4,7-trioxo-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carbonyl]oxymethyl] benzene-1,4-dicarboxylate (PubChem CID 70471233) has the molecular formula C26H28N2O14S2 and a molecular weight of 656.64 g/mol. Its IUPAC name is bis[[(2S,5R)-3,3-dimethyl-4,4,7-trioxo-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carbonyl]oxymethyl] benzene-1,4-dicarboxylate.
| Compound Name | bis[[(2S,5R)-3,3-dimethyl-4,4,7-trioxo-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carbonyl]oxymethyl] benzene-1,4-dicarboxylate |
|---|---|
| PubChem CID | 70471233 |
| Molecular Formula | C26H28N2O14S2 |
| Molecular Weight | 656.64 g/mol |
| Exact Mass | 656.10 |
| IUPAC Name | bis[[(2S,5R)-3,3-dimethyl-4,4,7-trioxo-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carbonyl]oxymethyl] benzene-1,4-dicarboxylate |
| SMILES | CC1(C)[C@H](C(=O)OCOC(=O)c2ccc(C(=O)OCOC(=O)[C@@H]3N4C(=O)C[C@H]4S(=O)(=O)C3(C)C)cc2)N2C(=O)C[C@H]2S1(=O)=O |
| InChI | InChI=1S/C26H28N2O14S2/c1-25(2)19(27-15(29)9-17(27)43(25,35)36)23(33)41-11-39-21(31)13-5-7-14(8-6-13)22(32)40-12-42-24(34)20-26(3,4)44(37,38)18-10-16(30)28(18)20/h5-8,17-20H,9-12H2,1-4H3/t17-,18-,19+,20+/m1/s1 |
| InChIKey | XSRIFPVSEGCFAF-ZRNYENFQSA-N |
| XLogP | -0.73 |
| TPSA | 214.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.64 |
| LogP ≤ 5 | -0.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|