C23H29N3O8S — CID 22826940
6-[[(2S,5R,6R)-6-[(2-amino-2-phenylacetyl)amino]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carbonyl]oxymethoxy]-6-oxohexanoic acid (PubChem CID 22826940) has the molecular formula C23H29N3O8S and a molecular weight of 507.57 g/mol. Its IUPAC name is 6-[[(2S,5R,6R)-6-[(2-amino-2-phenylacetyl)amino]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carbonyl]oxymethoxy]-6-oxohexanoic acid.
| Compound Name | 6-[[(2S,5R,6R)-6-[(2-amino-2-phenylacetyl)amino]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carbonyl]oxymethoxy]-6-oxohexanoic acid |
|---|---|
| PubChem CID | 22826940 |
| Molecular Formula | C23H29N3O8S |
| Molecular Weight | 507.57 g/mol |
| Exact Mass | 507.17 |
| IUPAC Name | 6-[[(2S,5R,6R)-6-[(2-amino-2-phenylacetyl)amino]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carbonyl]oxymethoxy]-6-oxohexanoic acid |
| SMILES | CC1(C)S[C@@H]2[C@H](NC(=O)C(N)c3ccccc3)C(=O)N2[C@H]1C(=O)OCOC(=O)CCCCC(=O)O |
| InChI | InChI=1S/C23H29N3O8S/c1-23(2)18(22(32)34-12-33-15(29)11-7-6-10-14(27)28)26-20(31)17(21(26)35-23)25-19(30)16(24)13-8-4-3-5-9-13/h3-5,8-9,16-18,21H,6-7,10-12,24H2,1-2H3,(H,25,30)(H,27,28)/t16?,17-,18+,21-/m1/s1 |
| InChIKey | HTPHLQLDSGZHQS-GKTUAVMOSA-N |
| XLogP | 0.92 |
| TPSA | 165.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.57 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|