C23H27N5O8S — CID 56637610
6-[[(2S,5R,6R)-6-[(2-azido-2-phenylacetyl)amino]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carbonyl]oxymethoxy]-6-oxohexanoic acid (PubChem CID 56637610) has the molecular formula C23H27N5O8S and a molecular weight of 533.56 g/mol. Its IUPAC name is 6-[[(2S,5R,6R)-6-[(2-azido-2-phenylacetyl)amino]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carbonyl]oxymethoxy]-6-oxohexanoic acid.
| Compound Name | 6-[[(2S,5R,6R)-6-[(2-azido-2-phenylacetyl)amino]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carbonyl]oxymethoxy]-6-oxohexanoic acid |
|---|---|
| PubChem CID | 56637610 |
| Molecular Formula | C23H27N5O8S |
| Molecular Weight | 533.56 g/mol |
| Exact Mass | 533.16 |
| IUPAC Name | 6-[[(2S,5R,6R)-6-[(2-azido-2-phenylacetyl)amino]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carbonyl]oxymethoxy]-6-oxohexanoic acid |
| SMILES | CC1(C)S[C@@H]2[C@H](NC(=O)C(N=[N+]=[N-])c3ccccc3)C(=O)N2[C@H]1C(=O)OCOC(=O)CCCCC(=O)O |
| InChI | InChI=1S/C23H27N5O8S/c1-23(2)18(22(34)36-12-35-15(31)11-7-6-10-14(29)30)28-20(33)17(21(28)37-23)25-19(32)16(26-27-24)13-8-4-3-5-9-13/h3-5,8-9,16-18,21H,6-7,10-12H2,1-2H3,(H,25,32)(H,29,30)/t16?,17-,18+,21-/m1/s1 |
| InChIKey | ZZOICSHTXPIUCI-GKTUAVMOSA-N |
| XLogP | 2.27 |
| TPSA | 188.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.56 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|