C17H27NO7S — CID 54483585
2-hexanoyloxypropan-2-yl (2S,5R)-3,3-dimethyl-4,4,7-trioxo-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate (PubChem CID 54483585) has the molecular formula C17H27NO7S and a molecular weight of 389.47 g/mol. Its IUPAC name is 2-hexanoyloxypropan-2-yl (2S,5R)-3,3-dimethyl-4,4,7-trioxo-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate.
| Compound Name | 2-hexanoyloxypropan-2-yl (2S,5R)-3,3-dimethyl-4,4,7-trioxo-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
|---|---|
| PubChem CID | 54483585 |
| Molecular Formula | C17H27NO7S |
| Molecular Weight | 389.47 g/mol |
| Exact Mass | 389.15 |
| IUPAC Name | 2-hexanoyloxypropan-2-yl (2S,5R)-3,3-dimethyl-4,4,7-trioxo-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
| SMILES | CCCCCC(=O)OC(C)(C)OC(=O)[C@@H]1N2C(=O)C[C@H]2S(=O)(=O)C1(C)C |
| InChI | InChI=1S/C17H27NO7S/c1-6-7-8-9-13(20)24-17(4,5)25-15(21)14-16(2,3)26(22,23)12-10-11(19)18(12)14/h12,14H,6-10H2,1-5H3/t12-,14+/m1/s1 |
| InChIKey | XQSWHDCETTWOND-OCCSQVGLSA-N |
| XLogP | 1.52 |
| TPSA | 107.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.47 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|