C14H20INO5S — CID 70431614
1-(2-methylpropanoyloxy)ethyl (2S,5R,6R)-6-iodo-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate (PubChem CID 70431614) has the molecular formula C14H20INO5S and a molecular weight of 441.29 g/mol. Its IUPAC name is 1-(2-methylpropanoyloxy)ethyl (2S,5R,6R)-6-iodo-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate.
| Compound Name | 1-(2-methylpropanoyloxy)ethyl (2S,5R,6R)-6-iodo-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
|---|---|
| PubChem CID | 70431614 |
| Molecular Formula | C14H20INO5S |
| Molecular Weight | 441.29 g/mol |
| Exact Mass | 441.01 |
| IUPAC Name | 1-(2-methylpropanoyloxy)ethyl (2S,5R,6R)-6-iodo-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
| SMILES | CC(OC(=O)C(C)C)OC(=O)[C@@H]1N2C(=O)[C@@H](I)[C@H]2SC1(C)C |
| InChI | InChI=1S/C14H20INO5S/c1-6(2)12(18)20-7(3)21-13(19)9-14(4,5)22-11-8(15)10(17)16(9)11/h6-9,11H,1-5H3/t7?,8-,9+,11-/m1/s1 |
| InChIKey | XAEIQTGIRKNZIR-DGPDRUAKSA-N |
| XLogP | 1.94 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.29 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|