C12H16INO5S — CID 70432204
1-acetyloxyethyl (2S,5R,6R)-6-iodo-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate (PubChem CID 70432204) has the molecular formula C12H16INO5S and a molecular weight of 413.23 g/mol. Its IUPAC name is 1-acetyloxyethyl (2S,5R,6R)-6-iodo-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate.
| Compound Name | 1-acetyloxyethyl (2S,5R,6R)-6-iodo-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
|---|---|
| PubChem CID | 70432204 |
| Molecular Formula | C12H16INO5S |
| Molecular Weight | 413.23 g/mol |
| Exact Mass | 412.98 |
| IUPAC Name | 1-acetyloxyethyl (2S,5R,6R)-6-iodo-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
| SMILES | CC(=O)OC(C)OC(=O)[C@@H]1N2C(=O)[C@@H](I)[C@H]2SC1(C)C |
| InChI | InChI=1S/C12H16INO5S/c1-5(15)18-6(2)19-11(17)8-12(3,4)20-10-7(13)9(16)14(8)10/h6-8,10H,1-4H3/t6?,7-,8+,10-/m1/s1 |
| InChIKey | AFGQFNBTZQBMGC-CXCKYUMJSA-N |
| XLogP | 1.30 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.23 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|