C8H6O2 — CID 56614668
3-(oxomethylidene)cyclohexa-1,4-diene-1-carbaldehyde (PubChem CID 56614668) has the molecular formula C8H6O2 and a molecular weight of 134.13 g/mol. Its IUPAC name is 3-(oxomethylidene)cyclohexa-1,4-diene-1-carbaldehyde.
| Compound Name | 3-(oxomethylidene)cyclohexa-1,4-diene-1-carbaldehyde |
|---|---|
| PubChem CID | 56614668 |
| Molecular Formula | C8H6O2 |
| Molecular Weight | 134.13 g/mol |
| Exact Mass | 134.04 |
| IUPAC Name | 3-(oxomethylidene)cyclohexa-1,4-diene-1-carbaldehyde |
| SMILES | O=C=C1C=CCC(C=O)=C1 |
| InChI | InChI=1S/C8H6O2/c9-5-7-2-1-3-8(4-7)6-10/h1-2,4,6H,3H2 |
| InChIKey | SNPXDHDPKRUEFC-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 134.13 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'ketene', 'substructure': 'N/A'} |
|---|