C14H10O3 — CID 54500537
(4-hydroxyphenyl)-[3-(oxomethylidene)cyclohexa-1,5-dien-1-yl]methanone (PubChem CID 54500537) has the molecular formula C14H10O3 and a molecular weight of 226.23 g/mol. Its IUPAC name is (4-hydroxyphenyl)-[3-(oxomethylidene)cyclohexa-1,5-dien-1-yl]methanone.
| Compound Name | (4-hydroxyphenyl)-[3-(oxomethylidene)cyclohexa-1,5-dien-1-yl]methanone |
|---|---|
| PubChem CID | 54500537 |
| Molecular Formula | C14H10O3 |
| Molecular Weight | 226.23 g/mol |
| Exact Mass | 226.06 |
| IUPAC Name | (4-hydroxyphenyl)-[3-(oxomethylidene)cyclohexa-1,5-dien-1-yl]methanone |
| SMILES | O=C=C1C=C(C(=O)c2ccc(O)cc2)C=CC1 |
| InChI | InChI=1S/C14H10O3/c15-9-10-2-1-3-12(8-10)14(17)11-4-6-13(16)7-5-11/h1,3-8,16H,2H2 |
| InChIKey | YCCGWVGHOQJLRN-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.23 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ketene', 'substructure': 'N/A'} |
|---|