C11H11NO2 — CID 130695751
2,5-dihydropyrrol-1-yl-(4-hydroxyphenyl)methanone (PubChem CID 130695751) has the molecular formula C11H11NO2 and a molecular weight of 189.21 g/mol. Its IUPAC name is 2,5-dihydropyrrol-1-yl-(4-hydroxyphenyl)methanone.
| Compound Name | 2,5-dihydropyrrol-1-yl-(4-hydroxyphenyl)methanone |
|---|---|
| PubChem CID | 130695751 |
| Molecular Formula | C11H11NO2 |
| Molecular Weight | 189.21 g/mol |
| Exact Mass | 189.08 |
| IUPAC Name | 2,5-dihydropyrrol-1-yl-(4-hydroxyphenyl)methanone |
| SMILES | O=C(c1ccc(O)cc1)N1CC=CC1 |
| InChI | InChI=1S/C11H11NO2/c13-10-5-3-9(4-6-10)11(14)12-7-1-2-8-12/h1-6,13H,7-8H2 |
| InChIKey | GRXUHTJZUBUGDJ-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.21 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|