C15H22N2O2 — CID 4740722
(4-hydroxyphenyl)-[4-(2-methylpropyl)piperazin-1-yl]methanone (PubChem CID 4740722) has the molecular formula C15H22N2O2 and a molecular weight of 262.35 g/mol. Its IUPAC name is (4-hydroxyphenyl)-[4-(2-methylpropyl)piperazin-1-yl]methanone.
| Compound Name | (4-hydroxyphenyl)-[4-(2-methylpropyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 4740722 |
| Molecular Formula | C15H22N2O2 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.17 |
| IUPAC Name | (4-hydroxyphenyl)-[4-(2-methylpropyl)piperazin-1-yl]methanone |
| SMILES | CC(C)CN1CCN(C(=O)c2ccc(O)cc2)CC1 |
| InChI | InChI=1S/C15H22N2O2/c1-12(2)11-16-7-9-17(10-8-16)15(19)13-3-5-14(18)6-4-13/h3-6,12,18H,7-11H2,1-2H3 |
| InChIKey | SGOKMEBACHVXAM-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |